C19H24O3 — CID 129299289
4-[2-[(4Z,6E)-4-ethenyl-7-hydroxynona-4,6,8-trienoxy]ethyl]phenol (PubChem CID 129299289) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-[2-[(4Z,6E)-4-ethenyl-7-hydroxynona-4,6,8-trienoxy]ethyl]phenol.
| Compound Name | 4-[2-[(4Z,6E)-4-ethenyl-7-hydroxynona-4,6,8-trienoxy]ethyl]phenol |
|---|---|
| PubChem CID | 129299289 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 4-[2-[(4Z,6E)-4-ethenyl-7-hydroxynona-4,6,8-trienoxy]ethyl]phenol |
| SMILES | C=C/C(=C\C=C(\O)C=C)CCCOCCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H24O3/c1-3-16(7-10-18(20)4-2)6-5-14-22-15-13-17-8-11-19(21)12-9-17/h3-4,7-12,20-21H,1-2,5-6,13-15H2/b16-7+,18-10+ |
| InChIKey | CAZLUEAFTRAFMT-NNLURMBGSA-N |
| XLogP | 4.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|