C17H21N3O3 — CID 78893909
N'-[4-(2-phenylethoxy)butanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78893909) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N'-[4-(2-phenylethoxy)butanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[4-(2-phenylethoxy)butanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78893909 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N'-[4-(2-phenylethoxy)butanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(CCCOCCc1ccccc1)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C17H21N3O3/c21-16(19-20-17(22)15-8-4-11-18-15)9-5-12-23-13-10-14-6-2-1-3-7-14/h1-4,6-8,11,18H,5,9-10,12-13H2,(H,19,21)(H,20,22) |
| InChIKey | IJJBYEBLAVEWAP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|