C11H17N3O3 — CID 78861087
N'-(3-propan-2-yloxypropanoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 78861087) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N'-(3-propan-2-yloxypropanoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-(3-propan-2-yloxypropanoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78861087 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N'-(3-propan-2-yloxypropanoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(C)OCCC(=O)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C11H17N3O3/c1-8(2)17-7-5-10(15)13-14-11(16)9-4-3-6-12-9/h3-4,6,8,12H,5,7H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | DISJIFSGHDULHG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|