C14H13Cl2N3O3 — CID 78893897
N'-[2-(3,4-dichlorophenoxy)propanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78893897) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenoxy)propanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[2-(3,4-dichlorophenoxy)propanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78893897 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N'-[2-(3,4-dichlorophenoxy)propanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | CC(Oc1ccc(Cl)c(Cl)c1)C(=O)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C14H13Cl2N3O3/c1-8(22-9-4-5-10(15)11(16)7-9)13(20)18-19-14(21)12-3-2-6-17-12/h2-8,17H,1H3,(H,18,20)(H,19,21) |
| InChIKey | XTKZWBANAVFBJO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|