C13H16N4O3 — CID 129302089
(2R,3R,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethenyl-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 129302089) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is (2R,3R,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethenyl-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethenyl-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 129302089 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2R,3R,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-ethenyl-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | C=C[C@]1(O)C[C@@H](CO)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C13H16N4O3/c1-2-13(19)5-8(6-18)20-12(13)17-4-3-9-10(14)15-7-16-11(9)17/h2-4,7-8,12,18-19H,1,5-6H2,(H2,14,15,16)/t8-,12+,13-/m0/s1 |
| InChIKey | ISRKXDKMSKRMTR-CKLFPEKLSA-N |
| XLogP | 0.21 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|