About 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine
2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine (PubChem CID 129304100) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine.
Analyze 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine (CID 129304100) is 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine is C1=CNC(C2=NCCN2)C=C1.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine?
The InChIKey is QAQPHDVUDXDFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-2-4-9-7(3-1)8-10-5-6-11-8/h1-4,7,9H,5-6H2,(H,10,11).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine?
2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine has a molecular weight of 149.20 g/mol, XLogP of 0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-yl)-1,2-dihydropyridine is sourced from PubChem (CID 129304100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).