C15H16F3N5O3 — CID 129304923
2-(2,2-dimethylhydrazinyl)-N-methyl-2-oxo-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide (PubChem CID 129304923) has the molecular formula C15H16F3N5O3 and a molecular weight of 371.32 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-N-methyl-2-oxo-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-N-methyl-2-oxo-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 129304923 |
| Molecular Formula | C15H16F3N5O3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-N-methyl-2-oxo-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
| SMILES | CN(C)NC(=O)C(=O)N(C)Cc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H16F3N5O3/c1-22(2)20-12(24)13(25)23(3)8-9-4-6-10(7-5-9)11-19-14(26-21-11)15(16,17)18/h4-7H,8H2,1-3H3,(H,20,24) |
| InChIKey | FWQREWNGNQCSFL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|