C41H32O7 — CID 129309489
5-[[4-[4-[(2,5-dihydroxynaphthalen-1-yl)methyl]phenyl]peroxyphenyl]methyl]-2-[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol (PubChem CID 129309489) has the molecular formula C41H32O7 and a molecular weight of 636.70 g/mol. Its IUPAC name is 5-[[4-[4-[(2,5-dihydroxynaphthalen-1-yl)methyl]phenyl]peroxyphenyl]methyl]-2-[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol.
| Compound Name | 5-[[4-[4-[(2,5-dihydroxynaphthalen-1-yl)methyl]phenyl]peroxyphenyl]methyl]-2-[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol |
|---|---|
| PubChem CID | 129309489 |
| Molecular Formula | C41H32O7 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 5-[[4-[4-[(2,5-dihydroxynaphthalen-1-yl)methyl]phenyl]peroxyphenyl]methyl]-2-[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol |
| SMILES | Oc1ccc(Cc2ccc3c(Cc4ccc(OOc5ccc(Cc6c(O)ccc7c(O)cccc67)cc5)cc4)c(O)ccc3c2O)cc1 |
| InChI | InChI=1S/C41H32O7/c42-29-11-4-25(5-12-29)22-28-10-17-33-35(41(28)46)19-21-40(45)37(33)24-27-8-15-31(16-9-27)48-47-30-13-6-26(7-14-30)23-36-32-2-1-3-38(43)34(32)18-20-39(36)44/h1-21,42-46H,22-24H2 |
| InChIKey | DECZTUVLUOOWPH-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|