About 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol
2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol (PubChem CID 129291824) has the molecular formula C24H20O4
and a molecular weight of 372.42 g/mol. Its IUPAC name is 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol.
Molecular Properties
| Compound Name | 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol |
| PubChem CID | 129291824 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol |
| SMILES | Oc1ccc(Cc2ccc3c(Cc4ccc(O)cc4)c(O)ccc3c2O)cc1 |
| InChI | InChI=1S/C24H20O4/c25-18-6-1-15(2-7-18)13-17-5-10-20-21(24(17)28)11-12-23(27)22(20)14-16-3-8-19(26)9-4-16/h1-12,25-28H,13-14H2 |
| InChIKey | VDMAOVGYABVONQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol?
The IUPAC name of 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol (CID 129291824) is 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol.
What is the SMILES notation for 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol?
The canonical SMILES for 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol is Oc1ccc(Cc2ccc3c(Cc4ccc(O)cc4)c(O)ccc3c2O)cc1.
What is the InChIKey of 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol?
The InChIKey is VDMAOVGYABVONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O4/c25-18-6-1-15(2-7-18)13-17-5-10-20-21(24(17)28)11-12-23(27)22(20)14-16-3-8-19(26)9-4-16/h1-12,25-28H,13-14H2.
What are the key properties of 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol?
2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol has a molecular weight of 372.42 g/mol, XLogP of 4.84, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol is sourced from PubChem (CID 129291824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).