C24H20O4 — CID 129291824
2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol (PubChem CID 129291824) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol.
| Compound Name | 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol |
|---|---|
| PubChem CID | 129291824 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2,5-bis[(4-hydroxyphenyl)methyl]naphthalene-1,6-diol |
| SMILES | Oc1ccc(Cc2ccc3c(Cc4ccc(O)cc4)c(O)ccc3c2O)cc1 |
| InChI | InChI=1S/C24H20O4/c25-18-6-1-15(2-7-18)13-17-5-10-20-21(24(17)28)11-12-23(27)22(20)14-16-3-8-19(26)9-4-16/h1-12,25-28H,13-14H2 |
| InChIKey | VDMAOVGYABVONQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |