About 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol
4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol (PubChem CID 129291927) has the molecular formula C17H14O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol.
Molecular Properties
| Compound Name | 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol |
| PubChem CID | 129291927 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol |
| SMILES | Oc1ccc(Cc2ccc(O)c3c(O)cccc23)cc1 |
| InChI | InChI=1S/C17H14O3/c18-13-7-4-11(5-8-13)10-12-6-9-16(20)17-14(12)2-1-3-15(17)19/h1-9,18-20H,10H2 |
| InChIKey | NREIGPKBFATWTH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol?
The IUPAC name of 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol (CID 129291927) is 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol.
What is the SMILES notation for 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol?
The canonical SMILES for 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol is Oc1ccc(Cc2ccc(O)c3c(O)cccc23)cc1.
What is the InChIKey of 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol?
The InChIKey is NREIGPKBFATWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O3/c18-13-7-4-11(5-8-13)10-12-6-9-16(20)17-14(12)2-1-3-15(17)19/h1-9,18-20H,10H2.
What are the key properties of 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol?
4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol has a molecular weight of 266.30 g/mol, XLogP of 3.55, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-hydroxyphenyl)methyl]naphthalene-1,8-diol is sourced from PubChem (CID 129291927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).