C31H26O6 — CID 129291858
2,5,7-tris[(4-hydroxyphenyl)methyl]naphthalene-1,3,8-triol (PubChem CID 129291858) has the molecular formula C31H26O6 and a molecular weight of 494.54 g/mol. Its IUPAC name is 2,5,7-tris[(4-hydroxyphenyl)methyl]naphthalene-1,3,8-triol.
| Compound Name | 2,5,7-tris[(4-hydroxyphenyl)methyl]naphthalene-1,3,8-triol |
|---|---|
| PubChem CID | 129291858 |
| Molecular Formula | C31H26O6 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2,5,7-tris[(4-hydroxyphenyl)methyl]naphthalene-1,3,8-triol |
| SMILES | Oc1ccc(Cc2cc(Cc3ccc(O)cc3)c3cc(O)c(Cc4ccc(O)cc4)c(O)c3c2O)cc1 |
| InChI | InChI=1S/C31H26O6/c32-23-7-1-18(2-8-23)13-21-16-22(14-19-3-9-24(33)10-4-19)30(36)29-26(21)17-28(35)27(31(29)37)15-20-5-11-25(34)12-6-20/h1-12,16-17,32-37H,13-15H2 |
| InChIKey | HDTKWHCKIXPALF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |