C34H27N3O — CID 129311815
2-[6-(1,2-dihydropyridin-2-yl)-1,2-dihydropyridin-2-yl]-18-oxa-2-azahexacyclo[13.11.0.03,12.04,9.017,25.019,24]hexacosa-1(26),3(12),4,6,8,10,13,15,17(25),20,22-undecaene (PubChem CID 129311815) has the molecular formula C34H27N3O and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-[6-(1,2-dihydropyridin-2-yl)-1,2-dihydropyridin-2-yl]-18-oxa-2-azahexacyclo[13.11.0.03,12.04,9.017,25.019,24]hexacosa-1(26),3(12),4,6,8,10,13,15,17(25),20,22-undecaene.
| Compound Name | 2-[6-(1,2-dihydropyridin-2-yl)-1,2-dihydropyridin-2-yl]-18-oxa-2-azahexacyclo[13.11.0.03,12.04,9.017,25.019,24]hexacosa-1(26),3(12),4,6,8,10,13,15,17(25),20,22-undecaene |
|---|---|
| PubChem CID | 129311815 |
| Molecular Formula | C34H27N3O |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-[6-(1,2-dihydropyridin-2-yl)-1,2-dihydropyridin-2-yl]-18-oxa-2-azahexacyclo[13.11.0.03,12.04,9.017,25.019,24]hexacosa-1(26),3(12),4,6,8,10,13,15,17(25),20,22-undecaene |
| SMILES | C1=CNC(C2=CC=CC(N3c4cc5c(cc4C=Cc4ccc6ccccc6c43)OC3C=CC=CC53)N2)C=C1 |
| InChI | InChI=1S/C34H27N3O/c1-2-9-25-22(8-1)15-16-23-17-18-24-20-32-27(26-10-3-4-13-31(26)38-32)21-30(24)37(34(23)25)33-14-7-12-29(36-33)28-11-5-6-19-35-28/h1-21,26,28,31,33,35-36H |
| InChIKey | KHLHTZWJZSZVTC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|