C17H11FO2 — CID 145218750
11-fluoro-7a,11a-dihydrobenzo[a]xanthen-12-one (PubChem CID 145218750) has the molecular formula C17H11FO2 and a molecular weight of 266.27 g/mol. Its IUPAC name is 11-fluoro-7a,11a-dihydrobenzo[a]xanthen-12-one.
| Compound Name | 11-fluoro-7a,11a-dihydrobenzo[a]xanthen-12-one |
|---|---|
| PubChem CID | 145218750 |
| Molecular Formula | C17H11FO2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 11-fluoro-7a,11a-dihydrobenzo[a]xanthen-12-one |
| SMILES | O=C1c2c(ccc3ccccc23)OC2C=CC=C(F)C12 |
| InChI | InChI=1S/C17H11FO2/c18-12-6-3-7-13-16(12)17(19)15-11-5-2-1-4-10(11)8-9-14(15)20-13/h1-9,13,16H |
| InChIKey | XVISORGDAVNSNZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |