C25H32O2 — CID 145204920
ethane;2-[(3E,5Z)-hepta-3,5-dien-3-yl]-2H-benzo[g][1]benzoxepin-1-one (PubChem CID 145204920) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-hepta-3,5-dien-3-yl]-2H-benzo[g][1]benzoxepin-1-one.
| Compound Name | ethane;2-[(3E,5Z)-hepta-3,5-dien-3-yl]-2H-benzo[g][1]benzoxepin-1-one |
|---|---|
| PubChem CID | 145204920 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | ethane;2-[(3E,5Z)-hepta-3,5-dien-3-yl]-2H-benzo[g][1]benzoxepin-1-one |
| SMILES | C/C=C\C=C(/CC)C1C=COc2ccc3ccccc3c2C1=O.CC.CC |
| InChI | InChI=1S/C21H20O2.2C2H6/c1-3-5-8-15(4-2)18-13-14-23-19-12-11-16-9-6-7-10-17(16)20(19)21(18)22;2*1-2/h3,5-14,18H,4H2,1-2H3;2*1-2H3/b5-3-,15-8+;; |
| InChIKey | WBAZWYYQTJRZCA-JVNXRWKUSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|