C8H7BrF3N3O2 — CID 129318987
3-bromo-2-(2,2,2-trifluoroethoxy)pyridine-4-carbohydrazide (PubChem CID 129318987) has the molecular formula C8H7BrF3N3O2 and a molecular weight of 314.06 g/mol. Its IUPAC name is 3-bromo-2-(2,2,2-trifluoroethoxy)pyridine-4-carbohydrazide.
| Compound Name | 3-bromo-2-(2,2,2-trifluoroethoxy)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 129318987 |
| Molecular Formula | C8H7BrF3N3O2 |
| Molecular Weight | 314.06 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 3-bromo-2-(2,2,2-trifluoroethoxy)pyridine-4-carbohydrazide |
| SMILES | NNC(=O)c1ccnc(OCC(F)(F)F)c1Br |
| InChI | InChI=1S/C8H7BrF3N3O2/c9-5-4(6(16)15-13)1-2-14-7(5)17-3-8(10,11)12/h1-2H,3,13H2,(H,15,16) |
| InChIKey | UGHLXILCXGTCET-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.06 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|