C9H11BF3NO2 — CID 129319081
[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-3-pyridinyl]boronic acid (PubChem CID 129319081) has the molecular formula C9H11BF3NO2 and a molecular weight of 233.00 g/mol. Its IUPAC name is [2-(1,1,1-trifluoro-2-methylpropan-2-yl)-3-pyridinyl]boronic acid.
| Compound Name | [2-(1,1,1-trifluoro-2-methylpropan-2-yl)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 129319081 |
| Molecular Formula | C9H11BF3NO2 |
| Molecular Weight | 233.00 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | [2-(1,1,1-trifluoro-2-methylpropan-2-yl)-3-pyridinyl]boronic acid |
| SMILES | CC(C)(c1ncccc1B(O)O)C(F)(F)F |
| InChI | InChI=1S/C9H11BF3NO2/c1-8(2,9(11,12)13)7-6(10(15)16)4-3-5-14-7/h3-5,15-16H,1-2H3 |
| InChIKey | SBKXEVGQKKEDQC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.00 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|