C9H18Cl2F2N2 — CID 129320018
3,3-difluoro-4-pyrrolidin-1-ylpiperidine;dihydrochloride (PubChem CID 129320018) has the molecular formula C9H18Cl2F2N2 and a molecular weight of 263.16 g/mol. Its IUPAC name is 3,3-difluoro-4-pyrrolidin-1-ylpiperidine;dihydrochloride.
| Compound Name | 3,3-difluoro-4-pyrrolidin-1-ylpiperidine;dihydrochloride |
|---|---|
| PubChem CID | 129320018 |
| Molecular Formula | C9H18Cl2F2N2 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3,3-difluoro-4-pyrrolidin-1-ylpiperidine;dihydrochloride |
| SMILES | Cl.Cl.FC1(F)CNCCC1N1CCCC1 |
| InChI | InChI=1S/C9H16F2N2.2ClH/c10-9(11)7-12-4-3-8(9)13-5-1-2-6-13;;/h8,12H,1-7H2;2*1H |
| InChIKey | GFTAKAVRDTUTBI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |