C20H26F3N5O2 — CID 165010805
4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]cyclohexane-1,3-dione (PubChem CID 165010805) has the molecular formula C20H26F3N5O2 and a molecular weight of 425.46 g/mol. Its IUPAC name is 4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]cyclohexane-1,3-dione.
| Compound Name | 4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 165010805 |
| Molecular Formula | C20H26F3N5O2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCN(C4CCNCC4(F)F)CC3)c(F)n2)C(=O)C1 |
| InChI | InChI=1S/C20H26F3N5O2/c21-19-15(3-4-18(26-19)25-14-2-1-13(29)11-16(14)30)27-7-9-28(10-8-27)17-5-6-24-12-20(17,22)23/h3-4,14,17,24H,1-2,5-12H2,(H,25,26) |
| InChIKey | MALGOEPJGNJRKM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|