C22H26F4N6O2 — CID 176558352
3-[6-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-5-fluoro-1-methylindazol-3-yl]-1-fluoropiperidine-2,6-dione (PubChem CID 176558352) has the molecular formula C22H26F4N6O2 and a molecular weight of 482.48 g/mol. Its IUPAC name is 3-[6-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-5-fluoro-1-methylindazol-3-yl]-1-fluoropiperidine-2,6-dione.
| Compound Name | 3-[6-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-5-fluoro-1-methylindazol-3-yl]-1-fluoropiperidine-2,6-dione |
|---|---|
| PubChem CID | 176558352 |
| Molecular Formula | C22H26F4N6O2 |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 3-[6-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-5-fluoro-1-methylindazol-3-yl]-1-fluoropiperidine-2,6-dione |
| SMILES | Cn1nc(C2CCC(=O)N(F)C2=O)c2cc(F)c(N3CCN(C4CCNCC4(F)F)CC3)cc21 |
| InChI | InChI=1S/C22H26F4N6O2/c1-29-16-11-17(30-6-8-31(9-7-30)18-4-5-27-12-22(18,24)25)15(23)10-14(16)20(28-29)13-2-3-19(33)32(26)21(13)34/h10-11,13,18,27H,2-9,12H2,1H3 |
| InChIKey | KOMBADMYDOFMIV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|