C10H12F3N3O — CID 129320690
(3R)-1-(5-amino-2-pyridinyl)-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 129320690) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is (3R)-1-(5-amino-2-pyridinyl)-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(5-amino-2-pyridinyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129320690 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (3R)-1-(5-amino-2-pyridinyl)-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | Nc1ccc(N2CC[C@](O)(C(F)(F)F)C2)nc1 |
| InChI | InChI=1S/C10H12F3N3O/c11-10(12,13)9(17)3-4-16(6-9)8-2-1-7(14)5-15-8/h1-2,5,17H,3-4,6,14H2/t9-/m1/s1 |
| InChIKey | XHDWTDWAULVXDH-SECBINFHSA-N |
| XLogP | 1.17 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |