About 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate
1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate (PubChem CID 129322465) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate |
| PubChem CID | 129322465 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate |
| SMILES | C[C@H](O)C(=O)OCc1ncc[nH]1 |
| InChI | InChI=1S/C7H10N2O3/c1-5(10)7(11)12-4-6-8-2-3-9-6/h2-3,5,10H,4H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | HDFGJHSKCCNNIN-YFKPBYRVSA-N |
| XLogP | -0.17 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate?
The IUPAC name of 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate (CID 129322465) is 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate.
What is the SMILES notation for 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate?
The canonical SMILES for 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate is C[C@H](O)C(=O)OCc1ncc[nH]1.
What is the InChIKey of 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate?
The InChIKey is HDFGJHSKCCNNIN-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5(10)7(11)12-4-6-8-2-3-9-6/h2-3,5,10H,4H2,1H3,(H,8,9)/t5-/m0/s1.
What are the key properties of 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate?
1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate has a molecular weight of 170.17 g/mol, XLogP of -0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-ylmethyl (2S)-2-hydroxypropanoate is sourced from PubChem (CID 129322465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).