C9H14N2O2 — CID 54274629
1H-imidazol-2-ylmethyl 2,2-dimethylpropanoate (PubChem CID 54274629) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1H-imidazol-2-ylmethyl 2,2-dimethylpropanoate.
| Compound Name | 1H-imidazol-2-ylmethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54274629 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1H-imidazol-2-ylmethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ncc[nH]1 |
| InChI | InChI=1S/C9H14N2O2/c1-9(2,3)8(12)13-6-7-10-4-5-11-7/h4-5H,6H2,1-3H3,(H,10,11) |
| InChIKey | RMOCLAOEMIMGCV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |