About 1H-imidazol-2-ylmethyl carbamate
1H-imidazol-2-ylmethyl carbamate (PubChem CID 23172617) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is 1H-imidazol-2-ylmethyl carbamate.
Molecular Properties
| Compound Name | 1H-imidazol-2-ylmethyl carbamate |
| PubChem CID | 23172617 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 1H-imidazol-2-ylmethyl carbamate |
| SMILES | NC(=O)OCc1ncc[nH]1 |
| InChI | InChI=1S/C5H7N3O2/c6-5(9)10-3-4-7-1-2-8-4/h1-2H,3H2,(H2,6,9)(H,7,8) |
| InChIKey | VYEOBHVTLDJXGD-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazol-2-ylmethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-ylmethyl carbamate?
The IUPAC name of 1H-imidazol-2-ylmethyl carbamate (CID 23172617) is 1H-imidazol-2-ylmethyl carbamate.
What is the SMILES notation for 1H-imidazol-2-ylmethyl carbamate?
The canonical SMILES for 1H-imidazol-2-ylmethyl carbamate is NC(=O)OCc1ncc[nH]1.
What is the InChIKey of 1H-imidazol-2-ylmethyl carbamate?
The InChIKey is VYEOBHVTLDJXGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c6-5(9)10-3-4-7-1-2-8-4/h1-2H,3H2,(H2,6,9)(H,7,8).
What are the key properties of 1H-imidazol-2-ylmethyl carbamate?
1H-imidazol-2-ylmethyl carbamate has a molecular weight of 141.13 g/mol, XLogP of 0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-ylmethyl carbamate is sourced from PubChem (CID 23172617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).