C10H10Br2N2O2 — CID 129322780
ethyl 2-[(3,6-dibromopyridazin-4-yl)methyl]prop-2-enoate (PubChem CID 129322780) has the molecular formula C10H10Br2N2O2 and a molecular weight of 350.01 g/mol. Its IUPAC name is ethyl 2-[(3,6-dibromopyridazin-4-yl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(3,6-dibromopyridazin-4-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 129322780 |
| Molecular Formula | C10H10Br2N2O2 |
| Molecular Weight | 350.01 g/mol |
| Exact Mass | 347.91 |
| IUPAC Name | ethyl 2-[(3,6-dibromopyridazin-4-yl)methyl]prop-2-enoate |
| SMILES | C=C(Cc1cc(Br)nnc1Br)C(=O)OCC |
| InChI | InChI=1S/C10H10Br2N2O2/c1-3-16-10(15)6(2)4-7-5-8(11)13-14-9(7)12/h5H,2-4H2,1H3 |
| InChIKey | AFTWDMSSDJAGFJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.01 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|