C9H10O2S3 — CID 134954484
ethyl 2-[(2-sulfanylidene-1,3-dithiol-4-yl)methyl]prop-2-enoate (PubChem CID 134954484) has the molecular formula C9H10O2S3 and a molecular weight of 246.38 g/mol. Its IUPAC name is ethyl 2-[(2-sulfanylidene-1,3-dithiol-4-yl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(2-sulfanylidene-1,3-dithiol-4-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 134954484 |
| Molecular Formula | C9H10O2S3 |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | ethyl 2-[(2-sulfanylidene-1,3-dithiol-4-yl)methyl]prop-2-enoate |
| SMILES | C=C(Cc1csc(=S)s1)C(=O)OCC |
| InChI | InChI=1S/C9H10O2S3/c1-3-11-8(10)6(2)4-7-5-13-9(12)14-7/h5H,2-4H2,1H3 |
| InChIKey | QHZIUSHJQFXHTD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|