C11H9F4NO2 — CID 10890700
ethyl 2-[(2,3,5,6-tetrafluoro-4-pyridinyl)methyl]prop-2-enoate (PubChem CID 10890700) has the molecular formula C11H9F4NO2 and a molecular weight of 263.19 g/mol. Its IUPAC name is ethyl 2-[(2,3,5,6-tetrafluoro-4-pyridinyl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(2,3,5,6-tetrafluoro-4-pyridinyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 10890700 |
| Molecular Formula | C11H9F4NO2 |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | ethyl 2-[(2,3,5,6-tetrafluoro-4-pyridinyl)methyl]prop-2-enoate |
| SMILES | C=C(Cc1c(F)c(F)nc(F)c1F)C(=O)OCC |
| InChI | InChI=1S/C11H9F4NO2/c1-3-18-11(17)5(2)4-6-7(12)9(14)16-10(15)8(6)13/h2-4H2,1H3 |
| InChIKey | RPCSWVQGYVIYSM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|