C12H14F4N2O2 — CID 21198210
ethyl 2-methyl-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate (PubChem CID 21198210) has the molecular formula C12H14F4N2O2 and a molecular weight of 294.25 g/mol. Its IUPAC name is ethyl 2-methyl-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate.
| Compound Name | ethyl 2-methyl-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 21198210 |
| Molecular Formula | C12H14F4N2O2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | ethyl 2-methyl-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)(C)N(C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C12H14F4N2O2/c1-5-20-11(19)12(2,3)18(4)8-6(13)9(15)17-10(16)7(8)14/h5H2,1-4H3 |
| InChIKey | LYOXINPAAGMCQS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|