C14H14F4N4O2 — CID 21198317
ethyl 3-(1H-imidazol-5-yl)-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate (PubChem CID 21198317) has the molecular formula C14H14F4N4O2 and a molecular weight of 346.28 g/mol. Its IUPAC name is ethyl 3-(1H-imidazol-5-yl)-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate.
| Compound Name | ethyl 3-(1H-imidazol-5-yl)-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 21198317 |
| Molecular Formula | C14H14F4N4O2 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | ethyl 3-(1H-imidazol-5-yl)-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanoate |
| SMILES | CCOC(=O)C(Cc1cnc[nH]1)N(C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C14H14F4N4O2/c1-3-24-14(23)8(4-7-5-19-6-20-7)22(2)11-9(15)12(17)21-13(18)10(11)16/h5-6,8H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | ZUFPRQCWXBZARW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|