C14H18F4N2O2 — CID 155764998
tert-butyl (3R)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butanoate (PubChem CID 155764998) has the molecular formula C14H18F4N2O2 and a molecular weight of 322.30 g/mol. Its IUPAC name is tert-butyl (3R)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butanoate.
| Compound Name | tert-butyl (3R)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butanoate |
|---|---|
| PubChem CID | 155764998 |
| Molecular Formula | C14H18F4N2O2 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | tert-butyl (3R)-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]butanoate |
| SMILES | C[C@H](CC(=O)OC(C)(C)C)N(C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C14H18F4N2O2/c1-7(6-8(21)22-14(2,3)4)20(5)11-9(15)12(17)19-13(18)10(11)16/h7H,6H2,1-5H3/t7-/m1/s1 |
| InChIKey | OGGCQKIBEPWXHS-SSDOTTSWSA-N |
| XLogP | 3.19 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|