C13H15F4N3O3 — CID 21198241
ethyl 5-amino-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-5-oxopentanoate (PubChem CID 21198241) has the molecular formula C13H15F4N3O3 and a molecular weight of 337.27 g/mol. Its IUPAC name is ethyl 5-amino-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-5-oxopentanoate.
| Compound Name | ethyl 5-amino-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 21198241 |
| Molecular Formula | C13H15F4N3O3 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | ethyl 5-amino-2-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-5-oxopentanoate |
| SMILES | CCOC(=O)C(CCC(N)=O)N(C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H15F4N3O3/c1-3-23-13(22)6(4-5-7(18)21)20(2)10-8(14)11(16)19-12(17)9(10)15/h6H,3-5H2,1-2H3,(H2,18,21) |
| InChIKey | ZKGANMUEDMNFLS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|