C16H12F4N2O3 — CID 135314125
ethyl 2-benzamido-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetate (PubChem CID 135314125) has the molecular formula C16H12F4N2O3 and a molecular weight of 356.28 g/mol. Its IUPAC name is ethyl 2-benzamido-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetate.
| Compound Name | ethyl 2-benzamido-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetate |
|---|---|
| PubChem CID | 135314125 |
| Molecular Formula | C16H12F4N2O3 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | ethyl 2-benzamido-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C16H12F4N2O3/c1-2-25-16(24)12(21-15(23)8-6-4-3-5-7-8)9-10(17)13(19)22-14(20)11(9)18/h3-7,12H,2H2,1H3,(H,21,23) |
| InChIKey | LHIKKRIAGGSNRW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|