C15H14ClNO3S — CID 72734768
ethyl 2-benzamido-2-(5-chlorothiophen-2-yl)acetate (PubChem CID 72734768) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is ethyl 2-benzamido-2-(5-chlorothiophen-2-yl)acetate.
| Compound Name | ethyl 2-benzamido-2-(5-chlorothiophen-2-yl)acetate |
|---|---|
| PubChem CID | 72734768 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | ethyl 2-benzamido-2-(5-chlorothiophen-2-yl)acetate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H14ClNO3S/c1-2-20-15(19)13(11-8-9-12(16)21-11)17-14(18)10-6-4-3-5-7-10/h3-9,13H,2H2,1H3,(H,17,18) |
| InChIKey | KQCPDXKPXVHFRF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |