C19H19FN2O5 — CID 134975279
ethyl 2-[[5-(4-fluorobenzoyl)-2,6-dimethoxypyrimidin-4-yl]methyl]prop-2-enoate (PubChem CID 134975279) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is ethyl 2-[[5-(4-fluorobenzoyl)-2,6-dimethoxypyrimidin-4-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[5-(4-fluorobenzoyl)-2,6-dimethoxypyrimidin-4-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 134975279 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl 2-[[5-(4-fluorobenzoyl)-2,6-dimethoxypyrimidin-4-yl]methyl]prop-2-enoate |
| SMILES | C=C(Cc1nc(OC)nc(OC)c1C(=O)c1ccc(F)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H19FN2O5/c1-5-27-18(24)11(2)10-14-15(17(25-3)22-19(21-14)26-4)16(23)12-6-8-13(20)9-7-12/h6-9H,2,5,10H2,1,3-4H3 |
| InChIKey | CZIHJDZTZBQHQJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|