C22H28N4O2 — CID 129325464
[(1'S,4R)-2,2-dimethylspiro[3H-chromene-4,2'-cyclopropane]-1'-yl]-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone (PubChem CID 129325464) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is [(1'S,4R)-2,2-dimethylspiro[3H-chromene-4,2'-cyclopropane]-1'-yl]-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone.
| Compound Name | [(1'S,4R)-2,2-dimethylspiro[3H-chromene-4,2'-cyclopropane]-1'-yl]-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 129325464 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(1'S,4R)-2,2-dimethylspiro[3H-chromene-4,2'-cyclopropane]-1'-yl]-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nc([C@H]2CCCN(C(=O)[C@H]3C[C@@]34CC(C)(C)Oc3ccccc34)C2)n[nH]1 |
| InChI | InChI=1S/C22H28N4O2/c1-14-23-19(25-24-14)15-7-6-10-26(12-15)20(27)17-11-22(17)13-21(2,3)28-18-9-5-4-8-16(18)22/h4-5,8-9,15,17H,6-7,10-13H2,1-3H3,(H,23,24,25)/t15-,17+,22-/m0/s1 |
| InChIKey | ZAYSSFRQQCGHSH-JIGPKXGUSA-N |
| XLogP | 3.34 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |