C18H19N5O3S — CID 129326288
(5S)-3-(1-benzothiophen-2-ylmethyl)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]imidazolidine-2,4-dione (PubChem CID 129326288) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is (5S)-3-(1-benzothiophen-2-ylmethyl)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1-benzothiophen-2-ylmethyl)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 129326288 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (5S)-3-(1-benzothiophen-2-ylmethyl)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]imidazolidine-2,4-dione |
| SMILES | COCCn1cc(C[C@@H]2NC(=O)N(Cc3cc4ccccc4s3)C2=O)nn1 |
| InChI | InChI=1S/C18H19N5O3S/c1-26-7-6-22-10-13(20-21-22)9-15-17(24)23(18(25)19-15)11-14-8-12-4-2-3-5-16(12)27-14/h2-5,8,10,15H,6-7,9,11H2,1H3,(H,19,25)/t15-/m0/s1 |
| InChIKey | IOZOUKVPQAZKRZ-HNNXBMFYSA-N |
| XLogP | 1.80 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|