C20H22N6O3 — CID 129326346
(5R)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 129326346) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is (5R)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 129326346 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (5R)-5-[[1-(2-methoxyethyl)triazol-4-yl]methyl]-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COCCn1cc(C[C@H]2NC(=O)N(Cc3cc(C)nc4ccccc34)C2=O)nn1 |
| InChI | InChI=1S/C20H22N6O3/c1-13-9-14(16-5-3-4-6-17(16)21-13)11-26-19(27)18(22-20(26)28)10-15-12-25(24-23-15)7-8-29-2/h3-6,9,12,18H,7-8,10-11H2,1-2H3,(H,22,28)/t18-/m1/s1 |
| InChIKey | JCBQPGOQOOYVNU-GOSISDBHSA-N |
| XLogP | 1.44 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|