C19H21N3O2 — CID 99783378
(5S)-5-cyclopropyl-5-ethyl-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 99783378) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (5S)-5-cyclopropyl-5-ethyl-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-cyclopropyl-5-ethyl-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99783378 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (5S)-5-cyclopropyl-5-ethyl-3-[(2-methylquinolin-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C2CC2)NC(=O)N(Cc2cc(C)nc3ccccc23)C1=O |
| InChI | InChI=1S/C19H21N3O2/c1-3-19(14-8-9-14)17(23)22(18(24)21-19)11-13-10-12(2)20-16-7-5-4-6-15(13)16/h4-7,10,14H,3,8-9,11H2,1-2H3,(H,21,24)/t19-/m0/s1 |
| InChIKey | JXFBSHGVOUVUBZ-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|