C19H21BrN2O2 — CID 129327629
(2R)-2-(3-bromophenyl)-2-[[(2S,3R)-2-phenyloxolan-3-yl]methylamino]acetamide (PubChem CID 129327629) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is (2R)-2-(3-bromophenyl)-2-[[(2S,3R)-2-phenyloxolan-3-yl]methylamino]acetamide.
| Compound Name | (2R)-2-(3-bromophenyl)-2-[[(2S,3R)-2-phenyloxolan-3-yl]methylamino]acetamide |
|---|---|
| PubChem CID | 129327629 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (2R)-2-(3-bromophenyl)-2-[[(2S,3R)-2-phenyloxolan-3-yl]methylamino]acetamide |
| SMILES | NC(=O)[C@H](NC[C@H]1CCO[C@@H]1c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H21BrN2O2/c20-16-8-4-7-14(11-16)17(19(21)23)22-12-15-9-10-24-18(15)13-5-2-1-3-6-13/h1-8,11,15,17-18,22H,9-10,12H2,(H2,21,23)/t15-,17-,18-/m1/s1 |
| InChIKey | AEUIDTZQVQZZOP-KBAYOESNSA-N |
| XLogP | 3.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |