C14H24N4O2 — CID 129329291
(2R)-2-hydroxy-1-[(3R)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-2-methylpentan-1-one (PubChem CID 129329291) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2R)-2-hydroxy-1-[(3R)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-2-methylpentan-1-one.
| Compound Name | (2R)-2-hydroxy-1-[(3R)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-2-methylpentan-1-one |
|---|---|
| PubChem CID | 129329291 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2R)-2-hydroxy-1-[(3R)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-2-methylpentan-1-one |
| SMILES | CCC[C@@](C)(O)C(=O)N1CCN(C)[C@@H](c2ncc[nH]2)C1 |
| InChI | InChI=1S/C14H24N4O2/c1-4-5-14(2,20)13(19)18-9-8-17(3)11(10-18)12-15-6-7-16-12/h6-7,11,20H,4-5,8-10H2,1-3H3,(H,15,16)/t11-,14-/m1/s1 |
| InChIKey | DXEYJNGCOGOVOZ-BXUZGUMPSA-N |
| XLogP | 0.78 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |