C16H22N4O2 — CID 129335318
(5-ethyl-3-methylfuran-2-yl)-[(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]methanone (PubChem CID 129335318) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (5-ethyl-3-methylfuran-2-yl)-[(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]methanone.
| Compound Name | (5-ethyl-3-methylfuran-2-yl)-[(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 129335318 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (5-ethyl-3-methylfuran-2-yl)-[(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]methanone |
| SMILES | CCc1cc(C)c(C(=O)N2CCN(C)[C@H](c3ncc[nH]3)C2)o1 |
| InChI | InChI=1S/C16H22N4O2/c1-4-12-9-11(2)14(22-12)16(21)20-8-7-19(3)13(10-20)15-17-5-6-18-15/h5-6,9,13H,4,7-8,10H2,1-3H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | PAJNMDHJEKLYIL-ZDUSSCGKSA-N |
| XLogP | 2.00 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |