C15H21N5OS — CID 129329748
(2S)-N-methyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 129329748) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is (2S)-N-methyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | (2S)-N-methyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 129329748 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2S)-N-methyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | Cc1nc2c(s1)CCC[C@H]2CN(C)C(=O)[C@H](C)n1cncn1 |
| InChI | InChI=1S/C15H21N5OS/c1-10(20-9-16-8-17-20)15(21)19(3)7-12-5-4-6-13-14(12)18-11(2)22-13/h8-10,12H,4-7H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | GLVUQTOEPCPPQC-JQWIXIFHSA-N |
| XLogP | 2.18 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |