C15H26N4O3 — CID 129330452
2-[[(1R)-cyclohex-2-en-1-yl]carbamoyl-[[(2S)-4-methylmorpholin-2-yl]methyl]amino]acetamide (PubChem CID 129330452) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[[(1R)-cyclohex-2-en-1-yl]carbamoyl-[[(2S)-4-methylmorpholin-2-yl]methyl]amino]acetamide.
| Compound Name | 2-[[(1R)-cyclohex-2-en-1-yl]carbamoyl-[[(2S)-4-methylmorpholin-2-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 129330452 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-[[(1R)-cyclohex-2-en-1-yl]carbamoyl-[[(2S)-4-methylmorpholin-2-yl]methyl]amino]acetamide |
| SMILES | CN1CCO[C@H](CN(CC(N)=O)C(=O)N[C@H]2C=CCCC2)C1 |
| InChI | InChI=1S/C15H26N4O3/c1-18-7-8-22-13(9-18)10-19(11-14(16)20)15(21)17-12-5-3-2-4-6-12/h3,5,12-13H,2,4,6-11H2,1H3,(H2,16,20)(H,17,21)/t12-,13-/m0/s1 |
| InChIKey | AQJNALRSVNCMAJ-STQMWFEESA-N |
| XLogP | -0.08 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|