C15H25N5O3 — CID 129341772
2-[[(2R)-4-methylmorpholin-2-yl]methyl-(2-pyrrol-1-ylethylcarbamoyl)amino]acetamide (PubChem CID 129341772) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[[(2R)-4-methylmorpholin-2-yl]methyl-(2-pyrrol-1-ylethylcarbamoyl)amino]acetamide.
| Compound Name | 2-[[(2R)-4-methylmorpholin-2-yl]methyl-(2-pyrrol-1-ylethylcarbamoyl)amino]acetamide |
|---|---|
| PubChem CID | 129341772 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-[[(2R)-4-methylmorpholin-2-yl]methyl-(2-pyrrol-1-ylethylcarbamoyl)amino]acetamide |
| SMILES | CN1CCO[C@@H](CN(CC(N)=O)C(=O)NCCn2cccc2)C1 |
| InChI | InChI=1S/C15H25N5O3/c1-18-8-9-23-13(10-18)11-20(12-14(16)21)15(22)17-4-7-19-5-2-3-6-19/h2-3,5-6,13H,4,7-12H2,1H3,(H2,16,21)(H,17,22)/t13-/m1/s1 |
| InChIKey | RVPFUQSLFDGFCE-CYBMUJFWSA-N |
| XLogP | -0.68 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |