C14H22N4O4 — CID 154753725
2-[furan-3-ylmethylcarbamoyl-[(4-methylmorpholin-2-yl)methyl]amino]acetamide (PubChem CID 154753725) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[furan-3-ylmethylcarbamoyl-[(4-methylmorpholin-2-yl)methyl]amino]acetamide.
| Compound Name | 2-[furan-3-ylmethylcarbamoyl-[(4-methylmorpholin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 154753725 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[furan-3-ylmethylcarbamoyl-[(4-methylmorpholin-2-yl)methyl]amino]acetamide |
| SMILES | CN1CCOC(CN(CC(N)=O)C(=O)NCc2ccoc2)C1 |
| InChI | InChI=1S/C14H22N4O4/c1-17-3-5-22-12(7-17)8-18(9-13(15)19)14(20)16-6-11-2-4-21-10-11/h2,4,10,12H,3,5-9H2,1H3,(H2,15,19)(H,16,20) |
| InChIKey | UBABBMZXBKKLQI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |