C16H21N7O2 — CID 129330963
N-ethyl-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridazine-3-carboxamide (PubChem CID 129330963) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-ethyl-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridazine-3-carboxamide.
| Compound Name | N-ethyl-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 129330963 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-ethyl-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridazine-3-carboxamide |
| SMILES | CCNC(=O)c1ccc(N[C@H]2CCCN(c3ncc[nH]c3=O)C2)nn1 |
| InChI | InChI=1S/C16H21N7O2/c1-2-17-15(24)12-5-6-13(22-21-12)20-11-4-3-9-23(10-11)14-16(25)19-8-7-18-14/h5-8,11H,2-4,9-10H2,1H3,(H,17,24)(H,19,25)(H,20,22)/t11-/m0/s1 |
| InChIKey | IRUYDDYQQKKLDT-NSHDSACASA-N |
| XLogP | 0.39 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |