C13H15ClN6O — CID 129473564
3-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]piperidin-1-yl]-1H-pyrazin-2-one (PubChem CID 129473564) has the molecular formula C13H15ClN6O and a molecular weight of 306.76 g/mol. Its IUPAC name is 3-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]piperidin-1-yl]-1H-pyrazin-2-one.
| Compound Name | 3-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]piperidin-1-yl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 129473564 |
| Molecular Formula | C13H15ClN6O |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]piperidin-1-yl]-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1N1CCC[C@@H](Nc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C13H15ClN6O/c14-9-6-17-13(18-7-9)19-10-2-1-5-20(8-10)11-12(21)16-4-3-15-11/h3-4,6-7,10H,1-2,5,8H2,(H,16,21)(H,17,18,19)/t10-/m1/s1 |
| InChIKey | IHLCDDKTWITRBT-SNVBAGLBSA-N |
| XLogP | 1.29 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |