C15H15ClN6O — CID 129473562
5-chloro-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridine-3-carbonitrile (PubChem CID 129473562) has the molecular formula C15H15ClN6O and a molecular weight of 330.78 g/mol. Its IUPAC name is 5-chloro-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 129473562 |
| Molecular Formula | C15H15ClN6O |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 5-chloro-6-[[(3S)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N[C@H]2CCCN(c3ncc[nH]c3=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClN6O/c16-12-6-10(7-17)8-20-13(12)21-11-2-1-5-22(9-11)14-15(23)19-4-3-18-14/h3-4,6,8,11H,1-2,5,9H2,(H,19,23)(H,20,21)/t11-/m0/s1 |
| InChIKey | IHFUHQFSUHNMMR-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |