C18H23NO4S — CID 129347982
1-[(4aR,8aS)-4,4-dioxo-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-2-(3-cyclopropylphenyl)ethanone (PubChem CID 129347982) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 1-[(4aR,8aS)-4,4-dioxo-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-2-(3-cyclopropylphenyl)ethanone.
| Compound Name | 1-[(4aR,8aS)-4,4-dioxo-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-2-(3-cyclopropylphenyl)ethanone |
|---|---|
| PubChem CID | 129347982 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-[(4aR,8aS)-4,4-dioxo-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-2-(3-cyclopropylphenyl)ethanone |
| SMILES | O=C(Cc1cccc(C2CC2)c1)N1CCS(=O)(=O)[C@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C18H23NO4S/c20-18(11-13-2-1-3-15(10-13)14-4-5-14)19-7-9-24(21,22)17-12-23-8-6-16(17)19/h1-3,10,14,16-17H,4-9,11-12H2/t16-,17-/m0/s1 |
| InChIKey | KSJSYPPWQGXGKH-IRXDYDNUSA-N |
| XLogP | 1.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |