C14H18ClNO5S2 — CID 128776261
1-(2-chloro-6-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide (PubChem CID 128776261) has the molecular formula C14H18ClNO5S2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide.
| Compound Name | 1-(2-chloro-6-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide |
|---|---|
| PubChem CID | 128776261 |
| Molecular Formula | C14H18ClNO5S2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide |
| SMILES | Cc1cccc(Cl)c1S(=O)(=O)N1CCS(=O)(=O)C2COCCC21 |
| InChI | InChI=1S/C14H18ClNO5S2/c1-10-3-2-4-11(15)14(10)23(19,20)16-6-8-22(17,18)13-9-21-7-5-12(13)16/h2-4,12-13H,5-9H2,1H3 |
| InChIKey | SPLVFVSQTPQXPH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |