C13H19NO5S2 — CID 167791329
4-(5-methylfuran-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide (PubChem CID 167791329) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-(5-methylfuran-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide.
| Compound Name | 4-(5-methylfuran-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide |
|---|---|
| PubChem CID | 167791329 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-(5-methylfuran-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCS(=O)(=O)C3CCCCC32)o1 |
| InChI | InChI=1S/C13H19NO5S2/c1-10-6-7-13(19-10)21(17,18)14-8-9-20(15,16)12-5-3-2-4-11(12)14/h6-7,11-12H,2-5,8-9H2,1H3 |
| InChIKey | UJGSSXKEAJGNGB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |